C40H34BBrN4O2 — CID 157131974
8-bromo-5-phenylpyrido[3,2-b]indole;5-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole (PubChem CID 157131974) has the molecular formula C40H34BBrN4O2 and a molecular weight of 693.45 g/mol. Its IUPAC name is 8-bromo-5-phenylpyrido[3,2-b]indole;5-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole.
| Compound Name | 8-bromo-5-phenylpyrido[3,2-b]indole;5-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole |
|---|---|
| PubChem CID | 157131974 |
| Molecular Formula | C40H34BBrN4O2 |
| Molecular Weight | 693.45 g/mol |
| Exact Mass | 692.20 |
| IUPAC Name | 8-bromo-5-phenylpyrido[3,2-b]indole;5-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[3,2-b]indole |
| SMILES | Brc1ccc2c(c1)c1ncccc1n2-c1ccccc1.CC1(C)OB(c2ccc3c(c2)c2ncccc2n3-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C23H23BN2O2.C17H11BrN2/c1-22(2)23(3,4)28-24(27-22)16-12-13-19-18(15-16)21-20(11-8-14-25-21)26(19)17-9-6-5-7-10-17;18-12-8-9-15-14(11-12)17-16(7-4-10-19-17)20(15)13-5-2-1-3-6-13/h5-15H,1-4H3;1-11H |
| InChIKey | AJEHHAPQBVGNGW-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.45 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|