C29H27NO3 — CID 157132619
2-[1-[[4-[4-(4-methylphenyl)butanoyl]phenyl]methyl]isoquinolin-4-yl]acetic acid (PubChem CID 157132619) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[1-[[4-[4-(4-methylphenyl)butanoyl]phenyl]methyl]isoquinolin-4-yl]acetic acid.
| Compound Name | 2-[1-[[4-[4-(4-methylphenyl)butanoyl]phenyl]methyl]isoquinolin-4-yl]acetic acid |
|---|---|
| PubChem CID | 157132619 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 2-[1-[[4-[4-(4-methylphenyl)butanoyl]phenyl]methyl]isoquinolin-4-yl]acetic acid |
| SMILES | Cc1ccc(CCCC(=O)c2ccc(Cc3ncc(CC(=O)O)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C29H27NO3/c1-20-9-11-21(12-10-20)5-4-8-28(31)23-15-13-22(14-16-23)17-27-26-7-3-2-6-25(26)24(19-30-27)18-29(32)33/h2-3,6-7,9-16,19H,4-5,8,17-18H2,1H3,(H,32,33) |
| InChIKey | AJGDJXSKBXPWOX-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |