About 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane
1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane (PubChem CID 157136289) has the molecular formula C18H38N2
and a molecular weight of 282.52 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane |
| PubChem CID | 157136289 |
| Molecular Formula | C18H38N2 |
| Molecular Weight | 282.52 g/mol |
| Exact Mass | 282.30 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane |
| SMILES | C1CC2CCC1CN2.C1CN2CCC1CC2.CC.CC |
| InChI | InChI=1S/2C7H13N.2C2H6/c1-4-8-5-2-7(1)3-6-8;1-3-7-4-2-6(1)5-8-7;2*1-2/h7H,1-6H2;6-8H,1-5H2;2*1-2H3 |
| InChIKey | AJQVSYWVZJZENF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane?
The IUPAC name of 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane (CID 157136289) is 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane.
What is the SMILES notation for 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane?
The canonical SMILES for 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane is C1CC2CCC1CN2.C1CN2CCC1CC2.CC.CC.
What is the InChIKey of 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane?
The InChIKey is AJQVSYWVZJZENF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H13N.2C2H6/c1-4-8-5-2-7(1)3-6-8;1-3-7-4-2-6(1)5-8-7;2*1-2/h7H,1-6H2;6-8H,1-5H2;2*1-2H3.
What are the key properties of 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane?
1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane has a molecular weight of 282.52 g/mol, XLogP of 4.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octane;2-azabicyclo[2.2.2]octane;ethane is sourced from PubChem (CID 157136289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).