C25H50N4O5 — CID 157140261
4-oxo-4-(pentylamino)-3-(propylamino)butanoic acid;4-oxo-N-pentyl-3-(propylamino)pentanamide (PubChem CID 157140261) has the molecular formula C25H50N4O5 and a molecular weight of 486.70 g/mol. Its IUPAC name is 4-oxo-4-(pentylamino)-3-(propylamino)butanoic acid;4-oxo-N-pentyl-3-(propylamino)pentanamide.
| Compound Name | 4-oxo-4-(pentylamino)-3-(propylamino)butanoic acid;4-oxo-N-pentyl-3-(propylamino)pentanamide |
|---|---|
| PubChem CID | 157140261 |
| Molecular Formula | C25H50N4O5 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.38 |
| IUPAC Name | 4-oxo-4-(pentylamino)-3-(propylamino)butanoic acid;4-oxo-N-pentyl-3-(propylamino)pentanamide |
| SMILES | CCCCCNC(=O)C(CC(=O)O)NCCC.CCCCCNC(=O)CC(NCCC)C(C)=O |
| InChI | InChI=1S/C13H26N2O2.C12H24N2O3/c1-4-6-7-9-15-13(17)10-12(11(3)16)14-8-5-2;1-3-5-6-8-14-12(17)10(9-11(15)16)13-7-4-2/h12,14H,4-10H2,1-3H3,(H,15,17);10,13H,3-9H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | AKCMPDSVGFWGQL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|