C44H26Cl2N8S2 — CID 157141830
2-[3-chloro-4-(8-thiophen-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]acetonitrile (PubChem CID 157141830) has the molecular formula C44H26Cl2N8S2 and a molecular weight of 801.79 g/mol. Its IUPAC name is 2-[3-chloro-4-(8-thiophen-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]acetonitrile.
| Compound Name | 2-[3-chloro-4-(8-thiophen-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 157141830 |
| Molecular Formula | C44H26Cl2N8S2 |
| Molecular Weight | 801.79 g/mol |
| Exact Mass | 800.11 |
| IUPAC Name | 2-[3-chloro-4-(8-thiophen-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]acetonitrile |
| SMILES | N#CCc1ccc(-n2cnc3cnc4ccc(-c5ccsc5)cc4c32)c(Cl)c1.N#CCc1ccc(-n2cnc3cnc4ccc(-c5ccsc5)cc4c32)c(Cl)c1 |
| InChI | InChI=1S/2C22H13ClN4S/c2*23-18-9-14(5-7-24)1-4-21(18)27-13-26-20-11-25-19-3-2-15(10-17(19)22(20)27)16-6-8-28-12-16/h2*1-4,6,8-13H,5H2 |
| InChIKey | AKGUUVYDHXATGS-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 109.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.79 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |