C44H24F2N8S2 — CID 69157596
2,3-bis[4-(7-fluoro-8-thiophen-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile (PubChem CID 69157596) has the molecular formula C44H24F2N8S2 and a molecular weight of 766.86 g/mol. Its IUPAC name is 2,3-bis[4-(7-fluoro-8-thiophen-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile.
| Compound Name | 2,3-bis[4-(7-fluoro-8-thiophen-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile |
|---|---|
| PubChem CID | 69157596 |
| Molecular Formula | C44H24F2N8S2 |
| Molecular Weight | 766.86 g/mol |
| Exact Mass | 766.15 |
| IUPAC Name | 2,3-bis[4-(7-fluoro-8-thiophen-3-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile |
| SMILES | N#CC(c1ccc(-n2cnc3cnc4cc(F)c(-c5ccsc5)cc4c32)cc1)C(C#N)c1ccc(-n2cnc3cnc4cc(F)c(-c5ccsc5)cc4c32)cc1 |
| InChI | InChI=1S/C44H24F2N8S2/c45-37-15-39-33(13-31(37)27-9-11-55-21-27)43-41(19-49-39)51-23-53(43)29-5-1-25(2-6-29)35(17-47)36(18-48)26-3-7-30(8-4-26)54-24-52-42-20-50-40-16-38(46)32(14-34(40)44(42)54)28-10-12-56-22-28/h1-16,19-24,35-36H |
| InChIKey | MYCOJGLEZLMWFY-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 109.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.86 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |