C19H13N5S — CID 11631533
6-(2-thiophen-3-ylimidazo[1,2-a]pyridin-6-yl)quinazolin-2-amine (PubChem CID 11631533) has the molecular formula C19H13N5S and a molecular weight of 343.42 g/mol. Its IUPAC name is 6-(2-thiophen-3-ylimidazo[1,2-a]pyridin-6-yl)quinazolin-2-amine.
| Compound Name | 6-(2-thiophen-3-ylimidazo[1,2-a]pyridin-6-yl)quinazolin-2-amine |
|---|---|
| PubChem CID | 11631533 |
| Molecular Formula | C19H13N5S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 6-(2-thiophen-3-ylimidazo[1,2-a]pyridin-6-yl)quinazolin-2-amine |
| SMILES | Nc1ncc2cc(-c3ccc4nc(-c5ccsc5)cn4c3)ccc2n1 |
| InChI | InChI=1S/C19H13N5S/c20-19-21-8-15-7-12(1-3-16(15)23-19)13-2-4-18-22-17(10-24(18)9-13)14-5-6-25-11-14/h1-11H,(H2,20,21,23) |
| InChIKey | HVDHNZZZNRUOOP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |