C23H22N2O6 — CID 157146573
2-hydroxybenzamide;2-[2-(3-methoxyphenyl)-2-oxoethoxy]benzamide (PubChem CID 157146573) has the molecular formula C23H22N2O6 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-hydroxybenzamide;2-[2-(3-methoxyphenyl)-2-oxoethoxy]benzamide.
| Compound Name | 2-hydroxybenzamide;2-[2-(3-methoxyphenyl)-2-oxoethoxy]benzamide |
|---|---|
| PubChem CID | 157146573 |
| Molecular Formula | C23H22N2O6 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 2-hydroxybenzamide;2-[2-(3-methoxyphenyl)-2-oxoethoxy]benzamide |
| SMILES | COc1cccc(C(=O)COc2ccccc2C(N)=O)c1.NC(=O)c1ccccc1O |
| InChI | InChI=1S/C16H15NO4.C7H7NO2/c1-20-12-6-4-5-11(9-12)14(18)10-21-15-8-3-2-7-13(15)16(17)19;8-7(10)5-3-1-2-4-6(5)9/h2-9H,10H2,1H3,(H2,17,19);1-4,9H,(H2,8,10) |
| InChIKey | AKTRURUFIUVXHE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |