C44H74N4O4Si — CID 157147139
1-[(Z)-8-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl]-3-pentylurea;1-[(Z)-8-hydroxyoct-5-enyl]-3-pentylurea (PubChem CID 157147139) has the molecular formula C44H74N4O4Si and a molecular weight of 751.19 g/mol. Its IUPAC name is 1-[(Z)-8-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl]-3-pentylurea;1-[(Z)-8-hydroxyoct-5-enyl]-3-pentylurea.
| Compound Name | 1-[(Z)-8-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl]-3-pentylurea;1-[(Z)-8-hydroxyoct-5-enyl]-3-pentylurea |
|---|---|
| PubChem CID | 157147139 |
| Molecular Formula | C44H74N4O4Si |
| Molecular Weight | 751.19 g/mol |
| Exact Mass | 750.55 |
| IUPAC Name | 1-[(Z)-8-[tert-butyl(diphenyl)silyl]oxyoct-5-enyl]-3-pentylurea;1-[(Z)-8-hydroxyoct-5-enyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCCCC/C=C\CCO.CCCCCNC(=O)NCCCC/C=C\CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H46N2O2Si.C14H28N2O2/c1-5-6-17-24-31-29(33)32-25-18-9-7-8-10-19-26-34-35(30(2,3)4,27-20-13-11-14-21-27)28-22-15-12-16-23-28;1-2-3-8-11-15-14(18)16-12-9-6-4-5-7-10-13-17/h8,10-16,20-23H,5-7,9,17-19,24-26H2,1-4H3,(H2,31,32,33);5,7,17H,2-4,6,8-13H2,1H3,(H2,15,16,18)/b10-8-;7-5- |
| InChIKey | AKVKABIISUONNU-PHOPSGCESA-N |
| XLogP | 8.75 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.19 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|