C19H31N9O12 — CID 157148974
3-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,7a-dihydro-3aH-triazolo[4,5-d]pyrimidine-5,7-dione;9-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,5-dihydro-3H-purine-2,6-dione (PubChem CID 157148974) has the molecular formula C19H31N9O12 and a molecular weight of 577.51 g/mol. Its IUPAC name is 3-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,7a-dihydro-3aH-triazolo[4,5-d]pyrimidine-5,7-dione;9-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,5-dihydro-3H-purine-2,6-dione.
| Compound Name | 3-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,7a-dihydro-3aH-triazolo[4,5-d]pyrimidine-5,7-dione;9-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,5-dihydro-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 157148974 |
| Molecular Formula | C19H31N9O12 |
| Molecular Weight | 577.51 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 3-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,7a-dihydro-3aH-triazolo[4,5-d]pyrimidine-5,7-dione;9-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,5-dihydro-3H-purine-2,6-dione |
| SMILES | O=C1NC(=O)C2N=CN(CC(O)[C@H](O)C(O)CO)C2N1.O=C1NC(=O)C2N=NN(CC(O)[C@H](O)C(O)CO)C2N1 |
| InChI | InChI=1S/C10H16N4O6.C9H15N5O6/c15-2-5(17)7(18)4(16)1-14-3-11-6-8(14)12-10(20)13-9(6)19;15-2-4(17)6(18)3(16)1-14-7-5(12-13-14)8(19)11-9(20)10-7/h3-8,15-18H,1-2H2,(H2,12,13,19,20);3-7,15-18H,1-2H2,(H2,10,11,19,20)/t4?,5?,6?,7-,8?;3?,4?,5?,6-,7?/m00/s1 |
| InChIKey | ALANPIZZXBWHNE-VBGBMVELSA-N |
| XLogP | -7.78 |
| TPSA | 321.80 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.51 |
| LogP ≤ 5 | -7.78 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 17 |