C10H16N4O6 — CID 58636311
9-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,5-dihydro-3H-purine-2,6-dione (PubChem CID 58636311) has the molecular formula C10H16N4O6 and a molecular weight of 288.26 g/mol. Its IUPAC name is 9-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,5-dihydro-3H-purine-2,6-dione.
| Compound Name | 9-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,5-dihydro-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 58636311 |
| Molecular Formula | C10H16N4O6 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 9-[(3S)-2,3,4,5-tetrahydroxypentyl]-4,5-dihydro-3H-purine-2,6-dione |
| SMILES | O=C1NC(=O)C2N=CN(CC(O)[C@H](O)C(O)CO)C2N1 |
| InChI | InChI=1S/C10H16N4O6/c15-2-5(17)7(18)4(16)1-14-3-11-6-8(14)12-10(20)13-9(6)19/h3-8,15-18H,1-2H2,(H2,12,13,19,20)/t4?,5?,6?,7-,8?/m0/s1 |
| InChIKey | OZNPBOFFTTUQMQ-IKTQEEBSSA-N |
| XLogP | -4.06 |
| TPSA | 154.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |