About 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde
6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde (PubChem CID 157149657) has the molecular formula C21H18BrNO2
and a molecular weight of 396.28 g/mol. Its IUPAC name is 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde.
Molecular Properties
| Compound Name | 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde |
| PubChem CID | 157149657 |
| Molecular Formula | C21H18BrNO2 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde |
| SMILES | Cc1ccc(-c2cccc(C=O)c2)cc1C.O=Cc1cccc(Br)n1 |
| InChI | InChI=1S/C15H14O.C6H4BrNO/c1-11-6-7-15(8-12(11)2)14-5-3-4-13(9-14)10-16;7-6-3-1-2-5(4-9)8-6/h3-10H,1-2H3;1-4H |
| InChIKey | ALCMSRNTQZWHTA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde?
The IUPAC name of 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde (CID 157149657) is 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde.
What is the SMILES notation for 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde?
The canonical SMILES for 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde is Cc1ccc(-c2cccc(C=O)c2)cc1C.O=Cc1cccc(Br)n1.
What is the InChIKey of 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde?
The InChIKey is ALCMSRNTQZWHTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O.C6H4BrNO/c1-11-6-7-15(8-12(11)2)14-5-3-4-13(9-14)10-16;7-6-3-1-2-5(4-9)8-6/h3-10H,1-2H3;1-4H.
What are the key properties of 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde?
6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde has a molecular weight of 396.28 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromopyridine-2-carbaldehyde;3-(3,4-dimethylphenyl)benzaldehyde is sourced from PubChem (CID 157149657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).