About adamantane-1-thiol;butane-1-thiol
adamantane-1-thiol;butane-1-thiol (PubChem CID 157153283) has the molecular formula C14H26S2
and a molecular weight of 258.50 g/mol. Its IUPAC name is adamantane-1-thiol;butane-1-thiol.
Molecular Properties
| Compound Name | adamantane-1-thiol;butane-1-thiol |
| PubChem CID | 157153283 |
| Molecular Formula | C14H26S2 |
| Molecular Weight | 258.50 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | adamantane-1-thiol;butane-1-thiol |
| SMILES | CCCCS.SC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C10H16S.C4H10S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-2-3-4-5/h7-9,11H,1-6H2;5H,2-4H2,1H3 |
| InChIKey | ALMXBEPHAKLHJY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze adamantane-1-thiol;butane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane-1-thiol;butane-1-thiol?
The IUPAC name of adamantane-1-thiol;butane-1-thiol (CID 157153283) is adamantane-1-thiol;butane-1-thiol.
What is the SMILES notation for adamantane-1-thiol;butane-1-thiol?
The canonical SMILES for adamantane-1-thiol;butane-1-thiol is CCCCS.SC12CC3CC(CC(C3)C1)C2.
What is the InChIKey of adamantane-1-thiol;butane-1-thiol?
The InChIKey is ALMXBEPHAKLHJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S.C4H10S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10;1-2-3-4-5/h7-9,11H,1-6H2;5H,2-4H2,1H3.
What are the key properties of adamantane-1-thiol;butane-1-thiol?
adamantane-1-thiol;butane-1-thiol has a molecular weight of 258.50 g/mol, XLogP of 4.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane-1-thiol;butane-1-thiol is sourced from PubChem (CID 157153283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).