C27H36O7 — CID 157153796
methanol;methyl 2-[3-(4-hydroxybutyl)phenyl]acetate;methyl 2-[3-(4-hydroxybut-1-ynyl)phenyl]acetate (PubChem CID 157153796) has the molecular formula C27H36O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is methanol;methyl 2-[3-(4-hydroxybutyl)phenyl]acetate;methyl 2-[3-(4-hydroxybut-1-ynyl)phenyl]acetate.
| Compound Name | methanol;methyl 2-[3-(4-hydroxybutyl)phenyl]acetate;methyl 2-[3-(4-hydroxybut-1-ynyl)phenyl]acetate |
|---|---|
| PubChem CID | 157153796 |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | methanol;methyl 2-[3-(4-hydroxybutyl)phenyl]acetate;methyl 2-[3-(4-hydroxybut-1-ynyl)phenyl]acetate |
| SMILES | CO.COC(=O)Cc1cccc(C#CCCO)c1.COC(=O)Cc1cccc(CCCCO)c1 |
| InChI | InChI=1S/C13H18O3.C13H14O3.CH4O/c2*1-16-13(15)10-12-7-4-6-11(9-12)5-2-3-8-14;1-2/h4,6-7,9,14H,2-3,5,8,10H2,1H3;4,6-7,9,14H,3,8,10H2,1H3;2H,1H3 |
| InChIKey | ALOLZQGSAJBEJN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|