C26H47NO7S2 — CID 157154053
1-[(2R,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-9-methyl-9-[2-[2-(3-oxobutoxy)ethoxy]ethyldisulfanyl]decane-1,6-dione (PubChem CID 157154053) has the molecular formula C26H47NO7S2 and a molecular weight of 549.80 g/mol. Its IUPAC name is 1-[(2R,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-9-methyl-9-[2-[2-(3-oxobutoxy)ethoxy]ethyldisulfanyl]decane-1,6-dione.
| Compound Name | 1-[(2R,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-9-methyl-9-[2-[2-(3-oxobutoxy)ethoxy]ethyldisulfanyl]decane-1,6-dione |
|---|---|
| PubChem CID | 157154053 |
| Molecular Formula | C26H47NO7S2 |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | 1-[(2R,4S)-4-methoxy-2-(methoxymethyl)pyrrolidin-1-yl]-9-methyl-9-[2-[2-(3-oxobutoxy)ethoxy]ethyldisulfanyl]decane-1,6-dione |
| SMILES | COC[C@H]1C[C@H](OC)CN1C(=O)CCCCC(=O)CCC(C)(C)SSCCOCCOCCC(C)=O |
| InChI | InChI=1S/C26H47NO7S2/c1-21(28)11-13-33-14-15-34-16-17-35-36-26(2,3)12-10-23(29)8-6-7-9-25(30)27-19-24(32-5)18-22(27)20-31-4/h22,24H,6-20H2,1-5H3/t22-,24+/m1/s1 |
| InChIKey | PCWNLHOSMSYZRU-VWNXMTODSA-N |
| XLogP | 4.33 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|