C22H33N3O2 — CID 157154524
cis-(1S,3S)-3-[[2-[(4-ethoxycyclohexyl)amino]-5-ethynylpyrimidin-4-yl]methyl]cycloheptan-1-ol (PubChem CID 157154524) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is cis-(1S,3S)-3-[[2-[(4-ethoxycyclohexyl)amino]-5-ethynylpyrimidin-4-yl]methyl]cycloheptan-1-ol.
| Compound Name | cis-(1S,3S)-3-[[2-[(4-ethoxycyclohexyl)amino]-5-ethynylpyrimidin-4-yl]methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 157154524 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | cis-(1S,3S)-3-[[2-[(4-ethoxycyclohexyl)amino]-5-ethynylpyrimidin-4-yl]methyl]cycloheptan-1-ol |
| SMILES | C#Cc1cnc(NC2CCC(OCC)CC2)nc1C[C@@H]1CCCC[C@H](O)C1 |
| InChI | InChI=1S/C22H33N3O2/c1-3-17-15-23-22(24-18-9-11-20(12-10-18)27-4-2)25-21(17)14-16-7-5-6-8-19(26)13-16/h1,15-16,18-20,26H,4-14H2,2H3,(H,23,24,25)/t16-,18?,19+,20?/m1/s1 |
| InChIKey | VFOQORQEFIVKCF-OTBHMBEGSA-N |
| XLogP | 3.70 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|