C21H31N3O2 — CID 160677323
cis-(1S,3S)-3-[[5-ethynyl-2-[(4-methoxycyclohexyl)amino]pyrimidin-4-yl]methyl]cycloheptan-1-ol (PubChem CID 160677323) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is cis-(1S,3S)-3-[[5-ethynyl-2-[(4-methoxycyclohexyl)amino]pyrimidin-4-yl]methyl]cycloheptan-1-ol.
| Compound Name | cis-(1S,3S)-3-[[5-ethynyl-2-[(4-methoxycyclohexyl)amino]pyrimidin-4-yl]methyl]cycloheptan-1-ol |
|---|---|
| PubChem CID | 160677323 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | cis-(1S,3S)-3-[[5-ethynyl-2-[(4-methoxycyclohexyl)amino]pyrimidin-4-yl]methyl]cycloheptan-1-ol |
| SMILES | C#Cc1cnc(NC2CCC(OC)CC2)nc1C[C@@H]1CCCC[C@H](O)C1 |
| InChI | InChI=1S/C21H31N3O2/c1-3-16-14-22-21(23-17-8-10-19(26-2)11-9-17)24-20(16)13-15-6-4-5-7-18(25)12-15/h1,14-15,17-19,25H,4-13H2,2H3,(H,22,23,24)/t15-,17?,18+,19?/m1/s1 |
| InChIKey | BNZOJINXAHTNEC-IZIZEDOESA-N |
| XLogP | 3.31 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|