C13H26N2 — CID 157157734
(4aS,7aS)-2,4a,7a-trimethyl-6-propan-2-yl-1,2,3,4,5,7-hexahydropyrrolo[3,4-b]pyridine (PubChem CID 157157734) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is (4aS,7aS)-2,4a,7a-trimethyl-6-propan-2-yl-1,2,3,4,5,7-hexahydropyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-2,4a,7a-trimethyl-6-propan-2-yl-1,2,3,4,5,7-hexahydropyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 157157734 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | (4aS,7aS)-2,4a,7a-trimethyl-6-propan-2-yl-1,2,3,4,5,7-hexahydropyrrolo[3,4-b]pyridine |
| SMILES | CC1CC[C@@]2(C)CN(C(C)C)C[C@@]2(C)N1 |
| InChI | InChI=1S/C13H26N2/c1-10(2)15-8-12(4)7-6-11(3)14-13(12,5)9-15/h10-11,14H,6-9H2,1-5H3/t11?,12-,13+/m0/s1 |
| InChIKey | HPLUUXCUFWPQAA-LWNNLKQOSA-N |
| XLogP | 2.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |