C36H42BBrN2O3 — CID 157157898
2-bromo-4-(2,2-dimethylpropyl)aniline;2-(2,2-dimethylpropyl)phenanthridine;(2-formylphenyl)boronic acid (PubChem CID 157157898) has the molecular formula C36H42BBrN2O3 and a molecular weight of 641.46 g/mol. Its IUPAC name is 2-bromo-4-(2,2-dimethylpropyl)aniline;2-(2,2-dimethylpropyl)phenanthridine;(2-formylphenyl)boronic acid.
| Compound Name | 2-bromo-4-(2,2-dimethylpropyl)aniline;2-(2,2-dimethylpropyl)phenanthridine;(2-formylphenyl)boronic acid |
|---|---|
| PubChem CID | 157157898 |
| Molecular Formula | C36H42BBrN2O3 |
| Molecular Weight | 641.46 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | 2-bromo-4-(2,2-dimethylpropyl)aniline;2-(2,2-dimethylpropyl)phenanthridine;(2-formylphenyl)boronic acid |
| SMILES | CC(C)(C)Cc1ccc(N)c(Br)c1.CC(C)(C)Cc1ccc2ncc3ccccc3c2c1.O=Cc1ccccc1B(O)O |
| InChI | InChI=1S/C18H19N.C11H16BrN.C7H7BO3/c1-18(2,3)11-13-8-9-17-16(10-13)15-7-5-4-6-14(15)12-19-17;1-11(2,3)7-8-4-5-10(13)9(12)6-8;9-5-6-3-1-2-4-7(6)8(10)11/h4-10,12H,11H2,1-3H3;4-6H,7,13H2,1-3H3;1-5,10-11H |
| InChIKey | AMAKRZNRZOFJRY-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.46 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|