C40H40BBrN2O6S — CID 90852352
8-bromo-6-tert-butylquinoline;(3-formylphenyl)boronic acid;3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]benzaldehyde (PubChem CID 90852352) has the molecular formula C40H40BBrN2O6S and a molecular weight of 767.55 g/mol. Its IUPAC name is 8-bromo-6-tert-butylquinoline;(3-formylphenyl)boronic acid;3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]benzaldehyde.
| Compound Name | 8-bromo-6-tert-butylquinoline;(3-formylphenyl)boronic acid;3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]benzaldehyde |
|---|---|
| PubChem CID | 90852352 |
| Molecular Formula | C40H40BBrN2O6S |
| Molecular Weight | 767.55 g/mol |
| Exact Mass | 766.19 |
| IUPAC Name | 8-bromo-6-tert-butylquinoline;(3-formylphenyl)boronic acid;3-[6-(2-methylsulfonylpropan-2-yl)quinolin-8-yl]benzaldehyde |
| SMILES | CC(C)(C)c1cc(Br)c2ncccc2c1.CC(C)(c1cc(-c2cccc(C=O)c2)c2ncccc2c1)S(C)(=O)=O.O=Cc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C20H19NO3S.C13H14BrN.C7H7BO3/c1-20(2,25(3,23)24)17-11-16-8-5-9-21-19(16)18(12-17)15-7-4-6-14(10-15)13-22;1-13(2,3)10-7-9-5-4-6-15-12(9)11(14)8-10;9-5-6-2-1-3-7(4-6)8(10)11/h4-13H,1-3H3;4-8H,1-3H3;1-5,10-11H |
| InChIKey | OJXQVHKOLFQKFG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.55 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|