C33H30Cl2F3N3O4 — CID 157172448
(2-amino-4,5-difluorophenyl)-(2-chlorophenyl)methanone;[2-amino-5-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-(2-chlorophenyl)methanone (PubChem CID 157172448) has the molecular formula C33H30Cl2F3N3O4 and a molecular weight of 660.52 g/mol. Its IUPAC name is (2-amino-4,5-difluorophenyl)-(2-chlorophenyl)methanone;[2-amino-5-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-(2-chlorophenyl)methanone.
| Compound Name | (2-amino-4,5-difluorophenyl)-(2-chlorophenyl)methanone;[2-amino-5-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-(2-chlorophenyl)methanone |
|---|---|
| PubChem CID | 157172448 |
| Molecular Formula | C33H30Cl2F3N3O4 |
| Molecular Weight | 660.52 g/mol |
| Exact Mass | 659.16 |
| IUPAC Name | (2-amino-4,5-difluorophenyl)-(2-chlorophenyl)methanone;[2-amino-5-fluoro-4-(3-morpholin-4-ylpropoxy)phenyl]-(2-chlorophenyl)methanone |
| SMILES | Nc1cc(F)c(F)cc1C(=O)c1ccccc1Cl.Nc1cc(OCCCN2CCOCC2)c(F)cc1C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C20H22ClFN2O3.C13H8ClF2NO/c21-16-5-2-1-4-14(16)20(25)15-12-17(22)19(13-18(15)23)27-9-3-6-24-7-10-26-11-8-24;14-9-4-2-1-3-7(9)13(18)8-5-10(15)11(16)6-12(8)17/h1-2,4-5,12-13H,3,6-11,23H2;1-6H,17H2 |
| InChIKey | ANQALAKRFJXLCR-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.52 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|