C21H26ClFN4O3 — CID 46179602
2-amino-N'-(3-chloro-4-fluorophenyl)-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzenecarboximidamide (PubChem CID 46179602) has the molecular formula C21H26ClFN4O3 and a molecular weight of 436.92 g/mol. Its IUPAC name is 2-amino-N'-(3-chloro-4-fluorophenyl)-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzenecarboximidamide.
| Compound Name | 2-amino-N'-(3-chloro-4-fluorophenyl)-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 46179602 |
| Molecular Formula | C21H26ClFN4O3 |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 2-amino-N'-(3-chloro-4-fluorophenyl)-4-methoxy-5-(3-morpholin-4-ylpropoxy)benzenecarboximidamide |
| SMILES | COc1cc(N)c(/C(N)=N/c2ccc(F)c(Cl)c2)cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C21H26ClFN4O3/c1-28-19-13-18(24)15(21(25)26-14-3-4-17(23)16(22)11-14)12-20(19)30-8-2-5-27-6-9-29-10-7-27/h3-4,11-13H,2,5-10,24H2,1H3,(H2,25,26) |
| InChIKey | OKWCHMSVEFFKHE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|