C25H30ClF2N5O2 — CID 89400079
N-[5-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-4-(methylamino)-2-(3-piperidin-1-ylpropoxy)phenyl]-2-fluoroprop-2-enamide (PubChem CID 89400079) has the molecular formula C25H30ClF2N5O2 and a molecular weight of 506.00 g/mol. Its IUPAC name is N-[5-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-4-(methylamino)-2-(3-piperidin-1-ylpropoxy)phenyl]-2-fluoroprop-2-enamide.
| Compound Name | N-[5-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-4-(methylamino)-2-(3-piperidin-1-ylpropoxy)phenyl]-2-fluoroprop-2-enamide |
|---|---|
| PubChem CID | 89400079 |
| Molecular Formula | C25H30ClF2N5O2 |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | N-[5-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-4-(methylamino)-2-(3-piperidin-1-ylpropoxy)phenyl]-2-fluoroprop-2-enamide |
| SMILES | C=C(F)C(=O)Nc1cc(/C(N)=N/c2ccc(F)c(Cl)c2)c(NC)cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C25H30ClF2N5O2/c1-16(27)25(34)32-22-14-18(24(29)31-17-7-8-20(28)19(26)13-17)21(30-2)15-23(22)35-12-6-11-33-9-4-3-5-10-33/h7-8,13-15,30H,1,3-6,9-12H2,2H3,(H2,29,31)(H,32,34) |
| InChIKey | UBMOTJGQBRKUAI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|