C17H24ClN3O4 — CID 67305101
[2-(methylamino)-2-oxoethyl] 4-[3-(2-chlorophenoxy)propyl]piperazine-1-carboxylate (PubChem CID 67305101) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-[3-(2-chlorophenoxy)propyl]piperazine-1-carboxylate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-[3-(2-chlorophenoxy)propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67305101 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-[3-(2-chlorophenoxy)propyl]piperazine-1-carboxylate |
| SMILES | CNC(=O)COC(=O)N1CCN(CCCOc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C17H24ClN3O4/c1-19-16(22)13-25-17(23)21-10-8-20(9-11-21)7-4-12-24-15-6-3-2-5-14(15)18/h2-3,5-6H,4,7-13H2,1H3,(H,19,22) |
| InChIKey | MSAFHXVXPHHPTH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|