C19H23Cl2N3O3 — CID 68997213
[2-(methylamino)-2-oxoethyl] 4-[5-(2,5-dichlorophenyl)pent-4-ynyl]piperazine-1-carboxylate (PubChem CID 68997213) has the molecular formula C19H23Cl2N3O3 and a molecular weight of 412.32 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-[5-(2,5-dichlorophenyl)pent-4-ynyl]piperazine-1-carboxylate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-[5-(2,5-dichlorophenyl)pent-4-ynyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 68997213 |
| Molecular Formula | C19H23Cl2N3O3 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-[5-(2,5-dichlorophenyl)pent-4-ynyl]piperazine-1-carboxylate |
| SMILES | CNC(=O)COC(=O)N1CCN(CCCC#Cc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H23Cl2N3O3/c1-22-18(25)14-27-19(26)24-11-9-23(10-12-24)8-4-2-3-5-15-13-16(20)6-7-17(15)21/h6-7,13H,2,4,8-12,14H2,1H3,(H,22,25) |
| InChIKey | YAFIXRCJOVFRDW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|