C19H22ClFN4 — CID 123170886
N'-(3-chloro-4-fluorophenyl)-2-(methylamino)-4-(pyrrolidin-1-ylmethyl)benzenecarboximidamide (PubChem CID 123170886) has the molecular formula C19H22ClFN4 and a molecular weight of 360.86 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-2-(methylamino)-4-(pyrrolidin-1-ylmethyl)benzenecarboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-2-(methylamino)-4-(pyrrolidin-1-ylmethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 123170886 |
| Molecular Formula | C19H22ClFN4 |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-2-(methylamino)-4-(pyrrolidin-1-ylmethyl)benzenecarboximidamide |
| SMILES | CNc1cc(CN2CCCC2)ccc1/C(N)=N/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClFN4/c1-23-18-10-13(12-25-8-2-3-9-25)4-6-15(18)19(22)24-14-5-7-17(21)16(20)11-14/h4-7,10-11,23H,2-3,8-9,12H2,1H3,(H2,22,24) |
| InChIKey | ZDGACSCQOFBJTK-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|