C29H40N4OSSi — CID 136506223
N'-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(methylamino)-5-[4-(pyrrolidin-1-ylmethyl)phenyl]thiophene-2-carboximidamide (PubChem CID 136506223) has the molecular formula C29H40N4OSSi and a molecular weight of 520.82 g/mol. Its IUPAC name is N'-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(methylamino)-5-[4-(pyrrolidin-1-ylmethyl)phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(methylamino)-5-[4-(pyrrolidin-1-ylmethyl)phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 136506223 |
| Molecular Formula | C29H40N4OSSi |
| Molecular Weight | 520.82 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | N'-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]-3-(methylamino)-5-[4-(pyrrolidin-1-ylmethyl)phenyl]thiophene-2-carboximidamide |
| SMILES | CNc1cc(-c2ccc(CN3CCCC3)cc2)sc1/C(N)=N/c1cccc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C29H40N4OSSi/c1-29(2,3)36(5,6)34-24-11-9-10-23(18-24)32-28(30)27-25(31-4)19-26(35-27)22-14-12-21(13-15-22)20-33-16-7-8-17-33/h9-15,18-19,31H,7-8,16-17,20H2,1-6H3,(H2,30,32) |
| InChIKey | VAFZVYYCDHBBKC-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.82 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|