C26H30ClF2N5O2 — CID 87059857
(E)-N-[5-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-4-(ethenylamino)-2-(2-fluoroethoxy)phenyl]-4-piperidin-1-ylbut-2-enamide (PubChem CID 87059857) has the molecular formula C26H30ClF2N5O2 and a molecular weight of 518.01 g/mol. Its IUPAC name is (E)-N-[5-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-4-(ethenylamino)-2-(2-fluoroethoxy)phenyl]-4-piperidin-1-ylbut-2-enamide.
| Compound Name | (E)-N-[5-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-4-(ethenylamino)-2-(2-fluoroethoxy)phenyl]-4-piperidin-1-ylbut-2-enamide |
|---|---|
| PubChem CID | 87059857 |
| Molecular Formula | C26H30ClF2N5O2 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | (E)-N-[5-[N'-(3-chloro-4-fluorophenyl)carbamimidoyl]-4-(ethenylamino)-2-(2-fluoroethoxy)phenyl]-4-piperidin-1-ylbut-2-enamide |
| SMILES | C=CNc1cc(OCCF)c(NC(=O)/C=C/CN2CCCCC2)cc1/C(N)=N/c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C26H30ClF2N5O2/c1-2-31-22-17-24(36-14-10-28)23(33-25(35)7-6-13-34-11-4-3-5-12-34)16-19(22)26(30)32-18-8-9-21(29)20(27)15-18/h2,6-9,15-17,31H,1,3-5,10-14H2,(H2,30,32)(H,33,35)/b7-6+ |
| InChIKey | QIIYZFWCQCBWAD-VOTSOKGWSA-N |
| XLogP | 5.40 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|