C24H34N2O6S — CID 157173428
N-(2,4-dimethylphenyl)-4-[3-(hydroxymethyl)morpholin-4-yl]-N-(2-methylpropyl)benzenesulfonamide;formic acid (PubChem CID 157173428) has the molecular formula C24H34N2O6S and a molecular weight of 478.61 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[3-(hydroxymethyl)morpholin-4-yl]-N-(2-methylpropyl)benzenesulfonamide;formic acid.
| Compound Name | N-(2,4-dimethylphenyl)-4-[3-(hydroxymethyl)morpholin-4-yl]-N-(2-methylpropyl)benzenesulfonamide;formic acid |
|---|---|
| PubChem CID | 157173428 |
| Molecular Formula | C24H34N2O6S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[3-(hydroxymethyl)morpholin-4-yl]-N-(2-methylpropyl)benzenesulfonamide;formic acid |
| SMILES | Cc1ccc(N(CC(C)C)S(=O)(=O)c2ccc(N3CCOCC3CO)cc2)c(C)c1.O=CO |
| InChI | InChI=1S/C23H32N2O4S.CH2O2/c1-17(2)14-25(23-10-5-18(3)13-19(23)4)30(27,28)22-8-6-20(7-9-22)24-11-12-29-16-21(24)15-26;2-1-3/h5-10,13,17,21,26H,11-12,14-16H2,1-4H3;1H,(H,2,3) |
| InChIKey | ANSUDUMLFFKEIC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|