About 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde
4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde (PubChem CID 157176627) has the molecular formula C20H26O3
and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde |
| PubChem CID | 157176627 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde |
| SMILES | COC(OC)c1ccc(C)c(C)c1.Cc1ccc(C=O)cc1C |
| InChI | InChI=1S/C11H16O2.C9H10O/c1-8-5-6-10(7-9(8)2)11(12-3)13-4;1-7-3-4-9(6-10)5-8(7)2/h5-7,11H,1-4H3;3-6H,1-2H3 |
| InChIKey | AOBWTLZUTABGAA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde?
The IUPAC name of 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde (CID 157176627) is 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde.
What is the SMILES notation for 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde?
The canonical SMILES for 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde is COC(OC)c1ccc(C)c(C)c1.Cc1ccc(C=O)cc1C.
What is the InChIKey of 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde?
The InChIKey is AOBWTLZUTABGAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2.C9H10O/c1-8-5-6-10(7-9(8)2)11(12-3)13-4;1-7-3-4-9(6-10)5-8(7)2/h5-7,11H,1-4H3;3-6H,1-2H3.
What are the key properties of 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde?
4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde has a molecular weight of 314.43 g/mol, XLogP of 4.71, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethoxymethyl)-1,2-dimethylbenzene;3,4-dimethylbenzaldehyde is sourced from PubChem (CID 157176627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).