C14H10BN4 — CID 157180106
CID 157180106 (PubChem CID 157180106) has the molecular formula C14H10BN4 and a molecular weight of 245.07 g/mol.
| Compound Name | CID 157180106 |
|---|---|
| PubChem CID | 157180106 |
| Molecular Formula | C14H10BN4 |
| Molecular Weight | 245.07 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | — |
| SMILES | C[B]c1nc2cnccc2n2c1nc1ccccc12 |
| InChI | InChI=1S/C14H10BN4/c1-15-13-14-18-9-4-2-3-5-11(9)19(14)12-6-7-16-8-10(12)17-13/h2-8H,1H3 |
| InChIKey | SLMRIFXKEVKBKX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.07 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|