C33H28F10O5 — CID 157183828
methyl 2-[(3S)-6-[[(1R)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate;(1S)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 157183828) has the molecular formula C33H28F10O5 and a molecular weight of 694.56 g/mol. Its IUPAC name is methyl 2-[(3S)-6-[[(1R)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate;(1S)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | methyl 2-[(3S)-6-[[(1R)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate;(1S)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 157183828 |
| Molecular Formula | C33H28F10O5 |
| Molecular Weight | 694.56 g/mol |
| Exact Mass | 694.18 |
| IUPAC Name | methyl 2-[(3S)-6-[[(1R)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate;(1S)-4-(1,1,2,2,2-pentafluoroethyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | COC(=O)C[C@@H]1COc2cc(O[C@@H]3CCc4c3cccc4C(F)(F)C(F)(F)F)ccc21.O[C@H]1CCc2c1cccc2C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C22H19F5O4.C11H9F5O/c1-29-20(28)9-12-11-30-19-10-13(5-6-14(12)19)31-18-8-7-15-16(18)3-2-4-17(15)21(23,24)22(25,26)27;12-10(13,11(14,15)16)8-3-1-2-7-6(8)4-5-9(7)17/h2-6,10,12,18H,7-9,11H2,1H3;1-3,9,17H,4-5H2/t12-,18-;9-/m10/s1 |
| InChIKey | AOWKSIZHBPJPSO-QLMBXOFVSA-N |
| XLogP | 8.77 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.56 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|