C28H23F5O4 — CID 86674163
methyl 2-[(3S)-6-[[(1R)-4-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate (PubChem CID 86674163) has the molecular formula C28H23F5O4 and a molecular weight of 518.48 g/mol. Its IUPAC name is methyl 2-[(3S)-6-[[(1R)-4-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate.
| Compound Name | methyl 2-[(3S)-6-[[(1R)-4-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate |
|---|---|
| PubChem CID | 86674163 |
| Molecular Formula | C28H23F5O4 |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | methyl 2-[(3S)-6-[[(1R)-4-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]-2,3-dihydro-1H-inden-1-yl]oxy]-2,3-dihydro-1-benzofuran-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1COc2cc(O[C@@H]3CCc4c(-c5ccccc5C(F)(F)C(F)(F)F)cccc43)ccc21 |
| InChI | InChI=1S/C28H23F5O4/c1-35-26(34)13-16-15-36-25-14-17(9-10-18(16)25)37-24-12-11-20-19(6-4-7-22(20)24)21-5-2-3-8-23(21)27(29,30)28(31,32)33/h2-10,14,16,24H,11-13,15H2,1H3/t16-,24-/m1/s1 |
| InChIKey | BZSWRWKJMVYCGM-VOIUYBSRSA-N |
| XLogP | 7.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|