C20H20N2O4 — CID 157186793
(E)-N-hydroxy-3-[4-[2-(2-phenylmethoxyethylideneamino)acetyl]phenyl]prop-2-enamide (PubChem CID 157186793) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[4-[2-(2-phenylmethoxyethylideneamino)acetyl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[4-[2-(2-phenylmethoxyethylideneamino)acetyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 157186793 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (E)-N-hydroxy-3-[4-[2-(2-phenylmethoxyethylideneamino)acetyl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(=O)C/N=C/COCc2ccccc2)cc1)NO |
| InChI | InChI=1S/C20H20N2O4/c23-19(14-21-12-13-26-15-17-4-2-1-3-5-17)18-9-6-16(7-10-18)8-11-20(24)22-25/h1-12,25H,13-15H2,(H,22,24)/b11-8+,21-12+ |
| InChIKey | HKUYLXLMJGNHAF-GIDSKACHSA-N |
| XLogP | 2.68 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|