C23H13ClF4N2O4S — CID 157187287
6-[2-(2-chloro-6-fluorophenyl)-2-oxoethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylindazole-3-carbaldehyde (PubChem CID 157187287) has the molecular formula C23H13ClF4N2O4S and a molecular weight of 524.88 g/mol. Its IUPAC name is 6-[2-(2-chloro-6-fluorophenyl)-2-oxoethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylindazole-3-carbaldehyde.
| Compound Name | 6-[2-(2-chloro-6-fluorophenyl)-2-oxoethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylindazole-3-carbaldehyde |
|---|---|
| PubChem CID | 157187287 |
| Molecular Formula | C23H13ClF4N2O4S |
| Molecular Weight | 524.88 g/mol |
| Exact Mass | 524.02 |
| IUPAC Name | 6-[2-(2-chloro-6-fluorophenyl)-2-oxoethyl]-1-[3-(trifluoromethyl)phenyl]sulfonylindazole-3-carbaldehyde |
| SMILES | O=Cc1nn(S(=O)(=O)c2cccc(C(F)(F)F)c2)c2cc(CC(=O)c3c(F)cccc3Cl)ccc12 |
| InChI | InChI=1S/C23H13ClF4N2O4S/c24-17-5-2-6-18(25)22(17)21(32)10-13-7-8-16-19(12-31)29-30(20(16)9-13)35(33,34)15-4-1-3-14(11-15)23(26,27)28/h1-9,11-12H,10H2 |
| InChIKey | AGQHNQBTGKEETA-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 86.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.88 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|