C23H16ClFN2O5S — CID 161172445
methyl 4-[6-[2-(2-chloro-6-fluorophenyl)-2-oxoethyl]indazol-1-yl]sulfonylbenzoate (PubChem CID 161172445) has the molecular formula C23H16ClFN2O5S and a molecular weight of 486.91 g/mol. Its IUPAC name is methyl 4-[6-[2-(2-chloro-6-fluorophenyl)-2-oxoethyl]indazol-1-yl]sulfonylbenzoate.
| Compound Name | methyl 4-[6-[2-(2-chloro-6-fluorophenyl)-2-oxoethyl]indazol-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 161172445 |
| Molecular Formula | C23H16ClFN2O5S |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | methyl 4-[6-[2-(2-chloro-6-fluorophenyl)-2-oxoethyl]indazol-1-yl]sulfonylbenzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)n2ncc3ccc(CC(=O)c4c(F)cccc4Cl)cc32)cc1 |
| InChI | InChI=1S/C23H16ClFN2O5S/c1-32-23(29)15-7-9-17(10-8-15)33(30,31)27-20-11-14(5-6-16(20)13-26-27)12-21(28)22-18(24)3-2-4-19(22)25/h2-11,13H,12H2,1H3 |
| InChIKey | URJCGYGXEGWOFC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |