About calcium;sulfurous acid;sulfate
calcium;sulfurous acid;sulfate (PubChem CID 157188643) has the molecular formula H2CaO7S2
and a molecular weight of 218.22 g/mol. Its IUPAC name is calcium;sulfurous acid;sulfate.
Molecular Properties
| Compound Name | calcium;sulfurous acid;sulfate |
| PubChem CID | 157188643 |
| Molecular Formula | H2CaO7S2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 217.89 |
| IUPAC Name | calcium;sulfurous acid;sulfate |
| SMILES | O=S(=O)([O-])[O-].O=S(O)O.[Ca+2] |
| InChI | InChI=1S/Ca.H2O4S.H2O3S/c;1-5(2,3)4;1-4(2)3/h;(H2,1,2,3,4);(H2,1,2,3)/q+2;;/p-2 |
| InChIKey | APKVNXZSDFMOME-UHFFFAOYSA-L |
| XLogP | -2.04 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze calcium;sulfurous acid;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;sulfurous acid;sulfate?
The IUPAC name of calcium;sulfurous acid;sulfate (CID 157188643) is calcium;sulfurous acid;sulfate.
What is the SMILES notation for calcium;sulfurous acid;sulfate?
The canonical SMILES for calcium;sulfurous acid;sulfate is O=S(=O)([O-])[O-].O=S(O)O.[Ca+2].
What is the InChIKey of calcium;sulfurous acid;sulfate?
The InChIKey is APKVNXZSDFMOME-UHFFFAOYSA-L. The full InChI is InChI=1S/Ca.H2O4S.H2O3S/c;1-5(2,3)4;1-4(2)3/h;(H2,1,2,3,4);(H2,1,2,3)/q+2;;/p-2.
What are the key properties of calcium;sulfurous acid;sulfate?
calcium;sulfurous acid;sulfate has a molecular weight of 218.22 g/mol, XLogP of -2.04, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;sulfurous acid;sulfate is sourced from PubChem (CID 157188643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).