About calcium;sulfur trioxide;sulfate
calcium;sulfur trioxide;sulfate (PubChem CID 158621545) has the molecular formula CaO7S2
and a molecular weight of 216.20 g/mol. Its IUPAC name is calcium;sulfur trioxide;sulfate.
Molecular Properties
| Compound Name | calcium;sulfur trioxide;sulfate |
| PubChem CID | 158621545 |
| Molecular Formula | CaO7S2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 215.87 |
| IUPAC Name | calcium;sulfur trioxide;sulfate |
| SMILES | O=S(=O)([O-])[O-].O=S(=O)=O.[Ca+2] |
| InChI | InChI=1S/Ca.H2O4S.O3S/c;1-5(2,3)4;1-4(2)3/h;(H2,1,2,3,4);/q+2;;/p-2 |
| InChIKey | HYBFHSPYICPGKD-UHFFFAOYSA-L |
| XLogP | -2.72 |
| TPSA | 131.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze calcium;sulfur trioxide;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;sulfur trioxide;sulfate?
The IUPAC name of calcium;sulfur trioxide;sulfate (CID 158621545) is calcium;sulfur trioxide;sulfate.
What is the SMILES notation for calcium;sulfur trioxide;sulfate?
The canonical SMILES for calcium;sulfur trioxide;sulfate is O=S(=O)([O-])[O-].O=S(=O)=O.[Ca+2].
What is the InChIKey of calcium;sulfur trioxide;sulfate?
The InChIKey is HYBFHSPYICPGKD-UHFFFAOYSA-L. The full InChI is InChI=1S/Ca.H2O4S.O3S/c;1-5(2,3)4;1-4(2)3/h;(H2,1,2,3,4);/q+2;;/p-2.
What are the key properties of calcium;sulfur trioxide;sulfate?
calcium;sulfur trioxide;sulfate has a molecular weight of 216.20 g/mol, XLogP of -2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;sulfur trioxide;sulfate is sourced from PubChem (CID 158621545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).