C35H32FNO4S — CID 157189206
1-[1-[2-[3-fluoro-4-[2-(5-pentylfuran-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-phenylethanone (PubChem CID 157189206) has the molecular formula C35H32FNO4S and a molecular weight of 581.71 g/mol. Its IUPAC name is 1-[1-[2-[3-fluoro-4-[2-(5-pentylfuran-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-phenylethanone.
| Compound Name | 1-[1-[2-[3-fluoro-4-[2-(5-pentylfuran-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-phenylethanone |
|---|---|
| PubChem CID | 157189206 |
| Molecular Formula | C35H32FNO4S |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.20 |
| IUPAC Name | 1-[1-[2-[3-fluoro-4-[2-(5-pentylfuran-2-yl)thieno[3,2-b]pyridin-7-yl]oxyphenyl]acetyl]cyclopropyl]-2-phenylethanone |
| SMILES | CCCCCc1ccc(-c2cc3nccc(Oc4ccc(CC(=O)C5(C(=O)Cc6ccccc6)CC5)cc4F)c3s2)o1 |
| InChI | InChI=1S/C35H32FNO4S/c1-2-3-5-10-25-12-14-29(40-25)31-22-27-34(42-31)30(15-18-37-27)41-28-13-11-24(19-26(28)36)21-33(39)35(16-17-35)32(38)20-23-8-6-4-7-9-23/h4,6-9,11-15,18-19,22H,2-3,5,10,16-17,20-21H2,1H3 |
| InChIKey | APMMVWADWSCKET-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|