C25H34O4 — CID 157190522
methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate;methyl 2-methylprop-2-enoate;tricyclo[5.2.1.02,6]deca-3,8-diene (PubChem CID 157190522) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate;methyl 2-methylprop-2-enoate;tricyclo[5.2.1.02,6]deca-3,8-diene.
| Compound Name | methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate;methyl 2-methylprop-2-enoate;tricyclo[5.2.1.02,6]deca-3,8-diene |
|---|---|
| PubChem CID | 157190522 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | methyl 2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate;methyl 2-methylprop-2-enoate;tricyclo[5.2.1.02,6]deca-3,8-diene |
| SMILES | C1=CC2C3C=CC(C3)C2C1.C=C(C)C(=O)OC.COC(=O)C1(C)CC2C=CC1C2 |
| InChI | InChI=1S/C10H14O2.C10H12.C5H8O2/c1-10(9(11)12-2)6-7-3-4-8(10)5-7;1-2-9-7-4-5-8(6-7)10(9)3-1;1-4(2)5(6)7-3/h3-4,7-8H,5-6H2,1-2H3;1-2,4-5,7-10H,3,6H2;1H2,2-3H3 |
| InChIKey | APQJLFNZODFIIB-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|