C28H42N2O2S2 — CID 15719169
1,4-bis[2-[(4-methoxyphenyl)methylsulfanyl]-2-methylpropyl]piperazine (PubChem CID 15719169) has the molecular formula C28H42N2O2S2 and a molecular weight of 502.79 g/mol. Its IUPAC name is 1,4-bis[2-[(4-methoxyphenyl)methylsulfanyl]-2-methylpropyl]piperazine.
| Compound Name | 1,4-bis[2-[(4-methoxyphenyl)methylsulfanyl]-2-methylpropyl]piperazine |
|---|---|
| PubChem CID | 15719169 |
| Molecular Formula | C28H42N2O2S2 |
| Molecular Weight | 502.79 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 1,4-bis[2-[(4-methoxyphenyl)methylsulfanyl]-2-methylpropyl]piperazine |
| SMILES | COc1ccc(CSC(C)(C)CN2CCN(CC(C)(C)SCc3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C28H42N2O2S2/c1-27(2,33-19-23-7-11-25(31-5)12-8-23)21-29-15-17-30(18-16-29)22-28(3,4)34-20-24-9-13-26(32-6)14-10-24/h7-14H,15-22H2,1-6H3 |
| InChIKey | NADWYIQQUACBIY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.79 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |