C8H12N2O2 — CID 157192400
N,4-dimethyl-2-nitroaniline;molecular hydrogen (PubChem CID 157192400) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is N,4-dimethyl-2-nitroaniline;molecular hydrogen.
| Compound Name | N,4-dimethyl-2-nitroaniline;molecular hydrogen |
|---|---|
| PubChem CID | 157192400 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | N,4-dimethyl-2-nitroaniline;molecular hydrogen |
| SMILES | CNc1ccc(C)cc1[N+](=O)[O-].[H][H] |
| InChI | InChI=1S/C8H10N2O2.H2/c1-6-3-4-7(9-2)8(5-6)10(11)12;/h3-5,9H,1-2H3;1H |
| InChIKey | APVUJFBJSZOBBA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|