C13H14N2O — CID 157192591
N,N-dimethyl-2-phenoxypyridin-3-amine (PubChem CID 157192591) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is N,N-dimethyl-2-phenoxypyridin-3-amine.
| Compound Name | N,N-dimethyl-2-phenoxypyridin-3-amine |
|---|---|
| PubChem CID | 157192591 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N,N-dimethyl-2-phenoxypyridin-3-amine |
| SMILES | CN(C)c1cccnc1Oc1ccccc1 |
| InChI | InChI=1S/C13H14N2O/c1-15(2)12-9-6-10-14-13(12)16-11-7-4-3-5-8-11/h3-10H,1-2H3 |
| InChIKey | OPDQNFRDQWVUQW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |