C25H33N5O5 — CID 157194222
tert-butyl (2S,4S)-4-methyl-2-[5-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 157194222) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-methyl-2-[5-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-methyl-2-[5-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157194222 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | tert-butyl (2S,4S)-4-methyl-2-[5-[(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | C[C@H]1C[C@@H](c2nnc([C@@H]3CC[C@@H]4CN3C(=O)N4OCc3ccccc3)o2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C25H33N5O5/c1-16-12-20(29(13-16)24(32)35-25(2,3)4)22-27-26-21(34-22)19-11-10-18-14-28(19)23(31)30(18)33-15-17-8-6-5-7-9-17/h5-9,16,18-20H,10-15H2,1-4H3/t16-,18+,19-,20-/m0/s1 |
| InChIKey | ODOVCOJPSVFBIA-RNQOJCNYSA-N |
| XLogP | 4.46 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |