C18H27N5O5 — CID 159284436
tert-butyl (2S,4R)-2-[5-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]-4-methylpyrrolidine-1-carboxylate (PubChem CID 159284436) has the molecular formula C18H27N5O5 and a molecular weight of 393.44 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-[5-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-[5-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 159284436 |
| Molecular Formula | C18H27N5O5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | tert-butyl (2S,4R)-2-[5-[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octan-2-yl]-1,3,4-oxadiazol-2-yl]-4-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@@H]1C[C@@H](c2nnc([C@@H]3CC[C@@H]4CN3C(=O)N4O)o2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H27N5O5/c1-10-7-13(22(8-10)17(25)28-18(2,3)4)15-20-19-14(27-15)12-6-5-11-9-21(12)16(24)23(11)26/h10-13,26H,5-9H2,1-4H3/t10-,11-,12+,13+/m1/s1 |
| InChIKey | LKWAMZLBBRETKP-NDBYEHHHSA-N |
| XLogP | 2.72 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|