C8H10N4O3 — CID 122595100
(2S)-6-hydroxy-2-(1,3,4-oxadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 122595100) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is (2S)-6-hydroxy-2-(1,3,4-oxadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S)-6-hydroxy-2-(1,3,4-oxadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 122595100 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (2S)-6-hydroxy-2-(1,3,4-oxadiazol-2-yl)-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N(O)C2CC[C@@H](c3nnco3)N1C2 |
| InChI | InChI=1S/C8H10N4O3/c13-8-11-3-5(12(8)14)1-2-6(11)7-10-9-4-15-7/h4-6,14H,1-3H2/t5?,6-/m0/s1 |
| InChIKey | QVVVDTOVKQYKIB-GDVGLLTNSA-N |
| XLogP | 0.40 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|