C6H9FN2O2 — CID 146346758
(2S,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 146346758) has the molecular formula C6H9FN2O2 and a molecular weight of 160.15 g/mol. Its IUPAC name is (2S,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 146346758 |
| Molecular Formula | C6H9FN2O2 |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (2S,5R)-2-fluoro-6-hydroxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N(O)[C@@H]2CC[C@H](F)N1C2 |
| InChI | InChI=1S/C6H9FN2O2/c7-5-2-1-4-3-8(5)6(10)9(4)11/h4-5,11H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | VUDKCDXFXRKNAG-RFZPGFLSSA-N |
| XLogP | 0.57 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|