C7H13N5O4S — CID 167432315
(2S,5R)-6-hydroxy-7-oxo-N'-sulfamoyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide (PubChem CID 167432315) has the molecular formula C7H13N5O4S and a molecular weight of 263.28 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-7-oxo-N'-sulfamoyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide.
| Compound Name | (2S,5R)-6-hydroxy-7-oxo-N'-sulfamoyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
|---|---|
| PubChem CID | 167432315 |
| Molecular Formula | C7H13N5O4S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | (2S,5R)-6-hydroxy-7-oxo-N'-sulfamoyl-1,6-diazabicyclo[3.2.1]octane-2-carboximidamide |
| SMILES | N/C(=N\S(N)(=O)=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C7H13N5O4S/c8-6(10-17(9,15)16)5-2-1-4-3-11(5)7(13)12(4)14/h4-5,14H,1-3H2,(H2,8,10)(H2,9,15,16)/t4-,5+/m1/s1 |
| InChIKey | UZDFYNLHJHLALC-UHNVWZDZSA-N |
| XLogP | -1.80 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|