C8H14N4O5S — CID 90228992
(2S)-6-hydroxy-N'-methylsulfonyl-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide (PubChem CID 90228992) has the molecular formula C8H14N4O5S and a molecular weight of 278.29 g/mol. Its IUPAC name is (2S)-6-hydroxy-N'-methylsulfonyl-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide.
| Compound Name | (2S)-6-hydroxy-N'-methylsulfonyl-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide |
|---|---|
| PubChem CID | 90228992 |
| Molecular Formula | C8H14N4O5S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | (2S)-6-hydroxy-N'-methylsulfonyl-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbohydrazide |
| SMILES | CS(=O)(=O)NNC(=O)[C@@H]1CCC2CN1C(=O)N2O |
| InChI | InChI=1S/C8H14N4O5S/c1-18(16,17)10-9-7(13)6-3-2-5-4-11(6)8(14)12(5)15/h5-6,10,15H,2-4H2,1H3,(H,9,13)/t5?,6-/m0/s1 |
| InChIKey | OAJHIRIRWDNUCG-GDVGLLTNSA-N |
| XLogP | -1.78 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|