C11H14N4O4 — CID 141438273
(2S,5R)-6-hydroxy-7-oxo-N-(1H-pyrrol-3-yloxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 141438273) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-7-oxo-N-(1H-pyrrol-3-yloxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (2S,5R)-6-hydroxy-7-oxo-N-(1H-pyrrol-3-yloxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 141438273 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (2S,5R)-6-hydroxy-7-oxo-N-(1H-pyrrol-3-yloxy)-1,6-diazabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | O=C(NOc1cc[nH]c1)[C@@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C11H14N4O4/c16-10(13-19-8-3-4-12-5-8)9-2-1-7-6-14(9)11(17)15(7)18/h3-5,7,9,12,18H,1-2,6H2,(H,13,16)/t7-,9+/m1/s1 |
| InChIKey | BJWCKDSVUWPHQV-APPZFPTMSA-N |
| XLogP | 0.08 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|